ChemNet > CAS > 13351-73-0 1-Methylbenzotriazole
13351-73-0 1-Methylbenzotriazole
상품명칭 |
1-Methylbenzotriazole |
영문 이름 |
1-Methylbenzotriazole;1H-Benzotriazole, 1-methyl-; 1-Methyl-1,2,3-benzotriazole; 4-26-00-00095 (Beilstein Handbook Reference); BRN 0118900; NSC 11743; 1-Methyl-1H-benzotriazole |
분자식 |
C7H7N3 |
분자량 |
133.1506 |
InChI |
InChI=1/C7H7N3/c1-10-7-5-3-2-4-6(7)8-9-10/h2-5H,1H3 |
cas번호 |
13351-73-0 |
EC번호 |
236-401-4 |
분자 구조 |
|
밀도 |
1.24g/cm3 |
비등점 |
270.5°C at 760 mmHg |
굴절 지수 |
1.658 |
인화점 |
117.4°C |
증기압 |
0.0113mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|