ChemNet > CAS > 13365-26-9 Dimethyl 3-nitrophthalate
13365-26-9 Dimethyl 3-nitrophthalate
상품명칭 |
Dimethyl 3-nitrophthalate |
영문 이름 |
Dimethyl 3-nitrophthalate; 3-Nitrophthalic acid dimethyl ester; dimethyl 3-nitrobenzene-1,2-dicarboxylate |
분자식 |
C10H9NO6 |
분자량 |
239.1816 |
InChI |
InChI=1/C10H9NO6/c1-16-9(12)6-4-3-5-7(11(14)15)8(6)10(13)17-2/h3-5H,1-2H3 |
cas번호 |
13365-26-9 |
분자 구조 |
|
밀도 |
1.35g/cm3 |
비등점 |
314.6°C at 760 mmHg |
굴절 지수 |
1.549 |
인화점 |
134.3°C |
증기압 |
0.000462mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|