13388-75-5 3,5-Dimethoxyphenylacetonitrile

상품명칭	3,5-Dimethoxyphenylacetonitrile
영문 이름	3,5-Dimethoxyphenylacetonitrile;
분자식	C₁₀H₁₁NO₂
분자량	177.1998
InChI	InChI=1/C10H11NO2/c1-12-9-5-8(3-4-11)6-10(7-9)13-2/h5-7H,3H2,1-2H3
cas번호	13388-75-5
EC번호	202-225-1
분자 구조
밀도	1.082g/cm³
비등점	316.7°C at 760 mmHg
굴절 지수	1.511
인화점	127.3°C
증기압	0.000404mmHg at 25°C
위험성 표시
리스크 규칙	R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
보안 규칙	S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.;