ChemNet > CAS > 13455-00-0 Diphosphorus tetraiodide
13455-00-0 Diphosphorus tetraiodide
상품명칭 |
Diphosphorus tetraiodide |
영문 이름 |
Diphosphorus tetraiodide; Phosphorus diiodide; tetraiododiphosphane |
분자식 |
I4P2 |
분자량 |
569.5654 |
InChI |
InChI=1/I4P2/c1-5(2)6(3)4 |
cas번호 |
13455-00-0 |
EC번호 |
236-646-7 |
분자 구조 |
|
녹는 점 |
125-128℃ |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
S7/9:Keep container tightly closed and in a well-ventilated place.;
|
|