ChemNet > CAS > 135-01-3 1,2-diethylbenzene
135-01-3 1,2-diethylbenzene
| 상품명칭 |
1,2-diethylbenzene |
| 영문 이름 |
1,2-diethylbenzene; Diethylbenzene; o-Diethylbenzene |
| 분자식 |
C10H14 |
| 분자량 |
134.2182 |
| InChI |
InChI=1/C10H14/c1-3-9-7-5-6-8-10(9)4-2/h5-8H,3-4H2,1-2H3 |
| cas번호 |
135-01-3 |
| EC번호 |
205-170-1 |
| 분자 구조 |
|
| 밀도 |
0.865g/cm3 |
| 비등점 |
183.5°C at 760 mmHg |
| 굴절 지수 |
1.496 |
| 인화점 |
49.4°C |
| 증기압 |
1.05mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
