ChemNet > CAS > 135072-15-0 4-benzyl-2-morpholinecarboxylic acid hydrochloride
135072-15-0 4-benzyl-2-morpholinecarboxylic acid hydrochloride
상품명칭 |
4-benzyl-2-morpholinecarboxylic acid hydrochloride |
영문 이름 |
4-benzyl-2-morpholinecarboxylic acid hydrochloride; 4-benzylmorpholine-2-carboxylic acid hydrochloride |
분자식 |
C12H15NO3 |
분자량 |
221.2524 |
InChI |
InChI=1/C12H15NO3/c14-12(15)11-9-13(6-7-16-11)8-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,14,15) |
cas번호 |
135072-15-0 |
분자 구조 |
|
밀도 |
1.235g/cm3 |
녹는 점 |
244℃ |
비등점 |
372.7°C at 760 mmHg |
굴절 지수 |
1.571 |
인화점 |
179.2°C |
증기압 |
3.25E-06mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|