ChemNet > CAS > 135145-90-3 2,5-Dichlorobenzeneboronic acid
135145-90-3 2,5-Dichlorobenzeneboronic acid
상품명칭 |
2,5-Dichlorobenzeneboronic acid |
영문 이름 |
2,5-Dichlorobenzeneboronic acid; 2,5-Dichlorophenylboronic acid |
분자식 |
C6H5BCl2O2 |
분자량 |
190.8197 |
InChI |
InChI=1/C6H5BCl2O2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,10-11H |
cas번호 |
135145-90-3 |
분자 구조 |
|
밀도 |
1.47g/cm3 |
녹는 점 |
150℃ |
비등점 |
343.6°C at 760 mmHg |
굴절 지수 |
1.577 |
인화점 |
161.6°C |
증기압 |
2.65E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|