135159-25-0 2,4,6-Trimethoxybenzeneboronic acid

상품명칭	2,4,6-Trimethoxybenzeneboronic acid
영문 이름	2,4,6-Trimethoxybenzeneboronic acid; 2,4,6-Trimethoxyphenylboronic acid
분자식	C₉H₁₃BO₅
분자량	212.0075
InChI	InChI=1/C9H13BO5/c1-13-6-4-7(14-2)9(10(11)12)8(5-6)15-3/h4-5,11-12H,1-3H3
cas번호	135159-25-0
분자 구조
밀도	1.21g/cm³
비등점	413.8°C at 760 mmHg
굴절 지수	1.513
인화점	204.1°C
증기압	1.37E-07mmHg at 25°C
위험성 표시
리스크 규칙	R36/37/38:Irritating to eyes, respiratory system and skin.;
보안 규칙	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;