ChemNet > CAS > 13524-04-4 1-(2-Chlorophenyl)ethanol
13524-04-4 1-(2-Chlorophenyl)ethanol
| 상품명칭 |
1-(2-Chlorophenyl)ethanol |
| 영문 이름 |
1-(2-Chlorophenyl)ethanol; 2-Chloro-alpha-methylbenzyl alcohol; (1S)-1-(2-chlorophenyl)ethanol; (1R)-1-(2-chlorophenyl)ethanol |
| 분자식 |
C8H9ClO |
| 분자량 |
156.6095 |
| InChI |
InChI=1/C8H9ClO/c1-6(10)7-4-2-3-5-8(7)9/h2-6,10H,1H3/t6-/m1/s1 |
| cas번호 |
13524-04-4 |
| EC번호 |
236-868-4 |
| 분자 구조 |
|
| 밀도 |
1.182g/cm3 |
| 비등점 |
231.4°C at 760 mmHg |
| 굴절 지수 |
1.55 |
| 인화점 |
93.8°C |
| 증기압 |
0.0348mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
