ChemNet > CAS > 13608-87-2 2',3',4'-Trichloroacetophenone
13608-87-2 2',3',4'-Trichloroacetophenone
상품명칭 |
2',3',4'-Trichloroacetophenone |
영문 이름 |
2',3',4'-Trichloroacetophenone; 1-(2,3,4-Trichlorophenyl)ethanone; 2,3,4-Trichloroacetophenone |
분자식 |
C8H5Cl3O |
분자량 |
223.4837 |
InChI |
InChI=1/C8H5Cl3O/c1-4(12)5-2-3-6(9)8(11)7(5)10/h2-3H,1H3 |
cas번호 |
13608-87-2 |
EC번호 |
237-092-9 |
분자 구조 |
|
밀도 |
1.425g/cm3 |
녹는 점 |
59-64℃ |
비등점 |
297.5°C at 760 mmHg |
굴절 지수 |
1.563 |
인화점 |
124.5°C |
증기압 |
0.00134mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|