ChemNet > CAS > 13692-14-3 Alpha-(Chloromethyl)-2,4-dichlorobenzyl alcohol
13692-14-3 Alpha-(Chloromethyl)-2,4-dichlorobenzyl alcohol
상품명칭 |
Alpha-(Chloromethyl)-2,4-dichlorobenzyl alcohol |
영문 이름 |
Alpha-(Chloromethyl)-2,4-dichlorobenzyl alcohol;alpha-(Chloromethyl)-2,4-dichlorobenzyl alcohol; 2-chloro-1-(2,4-dichlorophenyl)ethanol; (1S)-2-chloro-1-(2,4-dichlorophenyl)ethanol; (1R)-2-chloro-1-(2,4-dichlorophenyl)ethanol |
분자식 |
C8H7Cl3O |
분자량 |
225.4996 |
InChI |
InChI=1/C8H7Cl3O/c9-4-8(12)6-2-1-5(10)3-7(6)11/h1-3,8,12H,4H2/t8-/m0/s1 |
cas번호 |
13692-14-3 |
EC번호 |
237-206-7 |
분자 구조 |
|
밀도 |
1.447g/cm3 |
녹는 점 |
48-52℃ |
비등점 |
323.3°C at 760 mmHg |
굴절 지수 |
1.581 |
인화점 |
149.3°C |
증기압 |
0.000109mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|