ChemNet > CAS > 137-97-3 1,3-di-O-tolyl-2-thiourea
137-97-3 1,3-di-O-tolyl-2-thiourea
상품명칭 |
1,3-di-O-tolyl-2-thiourea |
영문 이름 |
1,3-di-O-tolyl-2-thiourea; Ditolylthiourea; N,N-Di-o-tolylthiourea; N,N-Bis(2-Methylphenyl)thiourea; N,N,N-trimethyl(phenyl)methanaminium bromide; 1,3-bis(2-methylphenyl)thiourea |
분자식 |
C15H16N2S |
분자량 |
256.3659 |
InChI |
InChI=1/C15H16N2S/c1-11-7-3-5-9-13(11)16-15(18)17-14-10-6-4-8-12(14)2/h3-10H,1-2H3,(H2,16,17,18) |
cas번호 |
137-97-3 |
EC번호 |
205-309-6 |
분자 구조 |
|
밀도 |
1.219g/cm3 |
녹는 점 |
157-159℃ |
비등점 |
367.5°C at 760 mmHg |
굴절 지수 |
1.707 |
인화점 |
176°C |
증기압 |
1.36E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|