ChemNet > CAS > 13816-33-6 4-Isopropylbenzonitrile
13816-33-6 4-Isopropylbenzonitrile
상품명칭 |
4-Isopropylbenzonitrile |
영문 이름 |
4-Isopropylbenzonitrile; 4-Cyanocumene; 4-(propan-2-yl)benzonitrile |
분자식 |
C10H11N |
분자량 |
145.201 |
InChI |
InChI=1/C10H11N/c1-8(2)10-5-3-9(7-11)4-6-10/h3-6,8H,1-2H3 |
cas번호 |
13816-33-6 |
EC번호 |
237-492-3 |
분자 구조 |
|
밀도 |
0.96g/cm3 |
비등점 |
231.5°C at 760 mmHg |
굴절 지수 |
1.515 |
인화점 |
93.6°C |
증기압 |
0.0623mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|