13861-22-8 Propargyl methacrylate
상품명칭 |
Propargyl methacrylate |
영문 이름 |
Propargyl methacrylate; Methacrylic acid propargyl ester~2-Propyn-1-yl 2-methylpropenoate; prop-2-yn-1-yl 2-methylprop-2-enoate |
분자식 |
C7H8O2 |
분자량 |
124.1372 |
InChI |
InChI=1/C7H8O2/c1-4-5-9-7(8)6(2)3/h1H,2,5H2,3H3 |
cas번호 |
13861-22-8 |
EC번호 |
237-599-5 |
분자 구조 |
|
밀도 |
0.983g/cm3 |
비등점 |
148.4°C at 760 mmHg |
굴절 지수 |
1.445 |
인화점 |
43.2°C |
증기압 |
4.23mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|