ChemNet > CAS > 13979-81-2 3,5-Dibromo-4-methylphenol
13979-81-2 3,5-Dibromo-4-methylphenol
| 상품명칭 |
3,5-Dibromo-4-methylphenol |
| 영문 이름 |
3,5-Dibromo-4-methylphenol; 3,5-Dibromo-p-cresol (OH=1); 3,5-Dibromo-p-cresol |
| 분자식 |
C7H6Br2O |
| 분자량 |
265.9299 |
| InChI |
InChI=1/C7H6Br2O/c1-4-6(8)2-5(10)3-7(4)9/h2-3,10H,1H3 |
| cas번호 |
13979-81-2 |
| EC번호 |
237-763-6 |
| 분자 구조 |
|
| 밀도 |
1.948g/cm3 |
| 비등점 |
293.1°C at 760 mmHg |
| 굴절 지수 |
1.626 |
| 인화점 |
131.1°C |
| 증기압 |
0.00101mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
