ChemNet > CAS > 14064-83-6 4-하이드록시-4'-니트로스틸벤
14064-83-6 4-하이드록시-4'-니트로스틸벤
| 상품명칭 |
4-하이드록시-4'-니트로스틸벤 |
| 별명 |
; 4- [2- (니트로 페닐) 에테닐] 페놀; 4- [2- (4- 니트로 페닐) 에테닐] 페놀; 4- [(E) -2- (4- 니트로 페닐) 에테닐] 페놀 |
| 영문 이름 |
4-Hydroxy-4'-nitrostilbene; 4-[2-(Nitrophenyl)ethenyl]phenol; 4-[2-(4-nitrophenyl)ethenyl]phenol; 4-[(E)-2-(4-nitrophenyl)ethenyl]phenol |
| 분자식 |
C14H11NO3 |
| 분자량 |
241.242 |
| InChI |
InChI=1/C14H11NO3/c16-14-9-5-12(6-10-14)2-1-11-3-7-13(8-4-11)15(17)18/h1-10,16H/b2-1+ |
| cas번호 |
14064-83-6 |
| 분자 구조 |
|
| 밀도 |
1.318g/cm3 |
| 비등점 |
389.8°C at 760 mmHg |
| 굴절 지수 |
1.717 |
| 인화점 |
164.5°C |
| 증기압 |
1.23E-06mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
