14065-32-8 메틸 10-클로로-10-옥소데카노에이트
| 상품명칭 |
메틸 10-클로로-10-옥소데카노에이트 |
| 별명 |
; 메틸 세바코일 클로라이드; 세바신산 모노메틸에스테르 모노클로라이드 |
| 영문 이름 |
methyl 10-chloro-10-oxodecanoate; Methyl sebacoyl chloride; Sebacinic acid monomethylester monochloride |
| 분자식 |
C11H19ClO3 |
| 분자량 |
234.7198 |
| InChI |
InChI=1/C11H19ClO3/c1-15-11(14)9-7-5-3-2-4-6-8-10(12)13/h2-9H2,1H3 |
| cas번호 |
14065-32-8 |
| 분자 구조 |
|
| 밀도 |
1.056g/cm3 |
| 비등점 |
286.3°C at 760 mmHg |
| 굴절 지수 |
1.449 |
| 인화점 |
102.4°C |
| 증기압 |
0.00266mmHg at 25°C |
| 위험성 표시 |
C:Corrosive;
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|