ChemNet > CAS > 141-79-7 Mesityl oxide, mixture of alpha- and beta-isomers
141-79-7 Mesityl oxide, mixture of alpha- and beta-isomers
상품명칭 |
Mesityl oxide, mixture of alpha- and beta-isomers |
영문 이름 |
Mesityl oxide, mixture of alpha- and beta-isomers; 4-Methyl-3-penten-2-one; Methyl isobutenyl ketone; Mesityl oxide; Isopropylidene acetone; 4-methylpent-3-en-2-one; MO; 2-Methyl-2-Penten-4-One |
분자식 |
C6H10O |
분자량 |
98.143 |
InChI |
InChI=1/C6H10O/c1-5(2)4-6(3)7/h4H,1-3H3 |
cas번호 |
141-79-7 |
EC번호 |
205-502-5 |
분자 구조 |
|
밀도 |
0.83g/cm3 |
녹는 점 |
-53℃ |
비등점 |
132.7°C at 760 mmHg |
굴절 지수 |
1.418 |
인화점 |
30.6°C |
물 용해도 |
28 g/L (20℃) |
증기압 |
8.76mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R10:;
R20/21/22:;
|
보안 규칙 |
S25:;
|
|