ChemNet > CAS > 1422-54-4 2-Bromo-6-fluorotoluene
1422-54-4 2-Bromo-6-fluorotoluene
| 상품명칭 |
2-Bromo-6-fluorotoluene |
| 영문 이름 |
2-Bromo-6-fluorotoluene; Bromofluorotoluene3; 5-chloro-6-fluoro-1,3-dihydro-2H-benzimidazole-2-thione |
| 분자식 |
C7H4ClFN2S |
| 분자량 |
202.6365 |
| InChI |
InChI=1/C7H4ClFN2S/c8-3-1-5-6(2-4(3)9)11-7(12)10-5/h1-2H,(H2,10,11,12) |
| cas번호 |
1422-54-4 |
| 분자 구조 |
|
| 밀도 |
1.63g/cm3 |
| 비등점 |
294°C at 760 mmHg |
| 굴절 지수 |
1.714 |
| 인화점 |
131.6°C |
| 증기압 |
0.00166mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
