1422-54-4 2-Bromo-6-fluorotoluene
상품명칭 |
2-Bromo-6-fluorotoluene |
영문 이름 |
2-Bromo-6-fluorotoluene; Bromofluorotoluene3; 5-chloro-6-fluoro-1,3-dihydro-2H-benzimidazole-2-thione |
분자식 |
C7H4ClFN2S |
분자량 |
202.6365 |
InChI |
InChI=1/C7H4ClFN2S/c8-3-1-5-6(2-4(3)9)11-7(12)10-5/h1-2H,(H2,10,11,12) |
cas번호 |
1422-54-4 |
분자 구조 |
|
밀도 |
1.63g/cm3 |
비등점 |
294°C at 760 mmHg |
굴절 지수 |
1.714 |
인화점 |
131.6°C |
증기압 |
0.00166mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|