ChemNet > CAS > 144284-25-3 2,4,5-trifluorobenzyl alcohol
144284-25-3 2,4,5-trifluorobenzyl alcohol
상품명칭 |
2,4,5-trifluorobenzyl alcohol |
영문 이름 |
2,4,5-trifluorobenzyl alcohol; (2,4,5-trifluorophenyl)methanol |
분자식 |
C7H5F3O |
분자량 |
162.11 |
InChI |
InChI=1/C6H3BrF2O/c7-3-1-2-4(10)6(9)5(3)8/h1-2,10H |
cas번호 |
144284-25-3 |
분자 구조 |
|
밀도 |
1.858g/cm3 |
비등점 |
213.308°C at 760 mmHg |
굴절 지수 |
1.55 |
인화점 |
82.806°C |
증기압 |
0.113mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|