ChemNet > CAS > 14444-77-0 Diethyl phenyl orthoformate
14444-77-0 Diethyl phenyl orthoformate
| 상품명칭 |
Diethyl phenyl orthoformate |
| 영문 이름 |
Diethyl phenyl orthoformate; Orthoformic acid diethyl phenyl ester; (diethoxymethoxy)benzene |
| 분자식 |
C11H16O3 |
| 분자량 |
196.2429 |
| InChI |
InChI=1/C11H16O3/c1-3-12-11(13-4-2)14-10-8-6-5-7-9-10/h5-9,11H,3-4H2,1-2H3 |
| cas번호 |
14444-77-0 |
| EC번호 |
238-421-9 |
| 분자 구조 |
|
| 밀도 |
1.019g/cm3 |
| 비등점 |
235.2°C at 760 mmHg |
| 굴절 지수 |
1.482 |
| 인화점 |
57.2°C |
| 증기압 |
0.0777mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
