ChemNet > CAS > 145240-28-4 4-n-Butylbenzeneboronic acid
145240-28-4 4-n-Butylbenzeneboronic acid
상품명칭 |
4-n-Butylbenzeneboronic acid |
영문 이름 |
4-n-Butylbenzeneboronic acid; 4-n-Butylphenylboronic acid; 4-Butylphenylboronic acid; (4-butylphenyl)boronic acid |
분자식 |
C10H15BO2 |
분자량 |
178.0359 |
InChI |
InChI=1/C10H15BO2/c1-2-3-4-9-5-7-10(8-6-9)11(12)13/h5-8,12-13H,2-4H2,1H3 |
cas번호 |
145240-28-4 |
분자 구조 |
|
밀도 |
1.03g/cm3 |
녹는 점 |
91-97℃ |
비등점 |
313.5°C at 760 mmHg |
굴절 지수 |
1.512 |
인화점 |
143.4°C |
증기압 |
0.00021mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|