ChemNet > CAS > 145349-76-4 4-(Ethylthio)benzeneboronic acid
145349-76-4 4-(Ethylthio)benzeneboronic acid
| 상품명칭 |
4-(Ethylthio)benzeneboronic acid |
| 영문 이름 |
4-(Ethylthio)benzeneboronic acid; 4-(Ethylthio)phenylboronic acid; [4-(ethylsulfanyl)phenyl]boronic acid; 4-Ethylthiophenylboronic acid |
| 분자식 |
C8H11BO2S |
| 분자량 |
182.0477 |
| InChI |
InChI=1/C8H11BO2S/c1-2-12-8-5-3-7(4-6-8)9(10)11/h3-6,10-11H,2H2,1H3 |
| cas번호 |
145349-76-4 |
| 분자 구조 |
|
| 밀도 |
1.18g/cm3 |
| 비등점 |
343.5°C at 760 mmHg |
| 굴절 지수 |
1.571 |
| 인화점 |
161.6°C |
| 증기압 |
2.68E-05mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
