ChemNet > CAS > 145689-34-5 2,3-difluorophenylacetonitrile
145689-34-5 2,3-difluorophenylacetonitrile
| 상품명칭 |
2,3-difluorophenylacetonitrile |
| 영문 이름 |
2,3-difluorophenylacetonitrile; 2,3-Difluorobenzylcyanide; 2,3-difluorophenylacetanitrile |
| 분자식 |
C8H5F2N |
| 분자량 |
153.1288 |
| InChI |
InChI=1/C8H5F2N/c9-7-3-1-2-6(4-5-11)8(7)10/h1-3H,4H2 |
| cas번호 |
145689-34-5 |
| 분자 구조 |
|
| 밀도 |
1.234g/cm3 |
| 비등점 |
216.9°C at 760 mmHg |
| 굴절 지수 |
1.487 |
| 인화점 |
85°C |
| 증기압 |
0.136mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
