ChemNet > CAS > 1457-47-2 N-Allylrhodanine
1457-47-2 N-Allylrhodanine
| 상품명칭 |
N-Allylrhodanine |
| 영문 이름 |
N-Allylrhodanine; |
| 분자식 |
C6H7NOS2 |
| 분자량 |
173.2559 |
| InChI |
InChI=1/C6H7NOS2/c1-2-3-7-5(8)4-10-6(7)9/h2H,1,3-4H2 |
| cas번호 |
1457-47-2 |
| EC번호 |
215-941-4 |
| 분자 구조 |
|
| 밀도 |
1.35g/cm3 |
| 녹는 점 |
43-46℃ |
| 비등점 |
248.8°C at 760 mmHg |
| 굴절 지수 |
1.651 |
| 인화점 |
104.3°C |
| 증기압 |
0.0238mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
