ChemNet > CAS > 14572-89-5 1-(4-Aminophenyl)ethanol
14572-89-5 1-(4-Aminophenyl)ethanol
상품명칭 |
1-(4-Aminophenyl)ethanol |
영문 이름 |
1-(4-Aminophenyl)ethanol; 4-Amino-alpha-methylbenzyl alcohol~4-Aminophenyl methyl carbinol~4-(alpha-Hydroxyethyl)aniline; (1S)-1-(4-aminophenyl)ethanol; (1R)-1-(4-aminophenyl)ethanol |
분자식 |
C8H11NO |
분자량 |
137.179 |
InChI |
InChI=1/C8H11NO/c1-6(10)7-2-4-8(9)5-3-7/h2-6,10H,9H2,1H3/t6-/m1/s1 |
cas번호 |
14572-89-5 |
EC번호 |
238-613-2 |
분자 구조 |
|
밀도 |
1.117g/cm3 |
비등점 |
288.5°C at 760 mmHg |
굴절 지수 |
1.592 |
인화점 |
128.3°C |
증기압 |
0.00108mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|