ChemNet > CAS > 1459-00-3 beta-Bromoisopropylbenzene
1459-00-3 beta-Bromoisopropylbenzene
| 상품명칭 |
beta-Bromoisopropylbenzene |
| 영문 이름 |
beta-Bromoisopropylbenzene; 1-Bromo-2-phenylpropane; beta-Bromocumene; 2-Phenylpropyl bromide; [(2S)-1-bromopropan-2-yl]benzene; β-Bromoisopropylbenzene |
| 분자식 |
C9H11Br |
| 분자량 |
199.0876 |
| InChI |
InChI=1/C9H11Br/c1-8(7-10)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3/t8-/m1/s1 |
| cas번호 |
1459-00-3 |
| EC번호 |
215-948-2 |
| 분자 구조 |
|
| 밀도 |
1.303g/cm3 |
| 비등점 |
188.5°C at 760 mmHg |
| 굴절 지수 |
1.543 |
| 인화점 |
85.9°C |
| 증기압 |
0.825mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
