ChemNet > CAS > 1460-18-0 1,15-Pentadecanedioic acid
1460-18-0 1,15-Pentadecanedioic acid
| 상품명칭 |
1,15-Pentadecanedioic acid |
| 영문 이름 |
1,15-Pentadecanedioic acid; Pentadecanedioic acid |
| 분자식 |
C15H28O4 |
| 분자량 |
272.3804 |
| InChI |
InChI=1/C15H28O4/c16-14(17)12-10-8-6-4-2-1-3-5-7-9-11-13-15(18)19/h1-13H2,(H,16,17)(H,18,19) |
| cas번호 |
1460-18-0 |
| 분자 구조 |
|
| 밀도 |
1.026g/cm3 |
| 녹는 점 |
113-114℃ |
| 비등점 |
445.8°C at 760 mmHg |
| 굴절 지수 |
1.474 |
| 인화점 |
237.5°C |
| 증기압 |
3.44E-09mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
