ChemNet > CAS > 146132-95-8 3,5,7-트리하이드록시-3',4',5'-트리메톡시플라본
146132-95-8 3,5,7-트리하이드록시-3',4',5'-트리메톡시플라본
상품명칭 |
3,5,7-트리하이드록시-3',4',5'-트리메톡시플라본 |
별명 |
; 미리세틴 트리메틸 에테르; 3,5,7- 트리 히드 록시 -2- (3,4,5- 트리 메 톡시 페닐) -4H- 크롬 -4- 온 |
영문 이름 |
3,5,7-Trihydroxy-3',4',5'-trimethoxyflavone; Myricetin trimethyl ether; 3,5,7-trihydroxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one |
분자식 |
C18H16O8 |
분자량 |
360.3148 |
InChI |
InChI=1/C18H16O8/c1-23-12-4-8(5-13(24-2)18(12)25-3)17-16(22)15(21)14-10(20)6-9(19)7-11(14)26-17/h4-7,19-20,22H,1-3H3 |
cas번호 |
146132-95-8 |
분자 구조 |
|
밀도 |
1.482g/cm3 |
비등점 |
585.2°C at 760 mmHg |
굴절 지수 |
1.658 |
인화점 |
213.9°C |
증기압 |
2.71E-14mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|