1475-12-3 1-(2,5-디클로로페닐)에탄올
상품명칭 |
1-(2,5-디클로로페닐)에탄올 |
별명 |
; 2,5- 디클로로 - 알파- 메틸 벤질 알코올 ~ 2,5- 디클로로 페닐 메틸 카르 비놀; 2,5-디클로로페닐 에탄올 |
영문 이름 |
1-(2,5-Dichlorophenyl)ethanol; 2,5-Dichloro-alpha-methylbenzyl alcohol~2,5-Dichlorophenyl methyl carbinol; 2,5-Dichlorophenyl Ethanol |
분자식 |
C8H8Cl2O |
분자량 |
191.0545 |
InChI |
InChI=1/C8H8Cl2O/c1-5(11)7-4-6(9)2-3-8(7)10/h2-5,11H,1H3 |
cas번호 |
1475-12-3 |
EC번호 |
216-018-9 |
분자 구조 |
|
밀도 |
1.323g/cm3 |
비등점 |
257.9°C at 760 mmHg |
굴절 지수 |
1.566 |
인화점 |
112.1°C |
증기압 |
0.00725mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|