ChemNet > CAS > 148-87-8 3-(N-ethylanilino)propiononitrile
148-87-8 3-(N-ethylanilino)propiononitrile
상품명칭 |
3-(N-ethylanilino)propiononitrile |
영문 이름 |
3-(N-ethylanilino)propiononitrile; N-(2-Cyanoethyl)-N-ethylaniline; 3-(N-Ethylanilino)propionitrile; N-ethyl-N-cyanoethylaniline; 3-[ethyl(phenyl)amino]propanenitrile; 3-Ethylanilinopropiononitrile |
분자식 |
C11H14N2 |
분자량 |
174.2423 |
InChI |
InChI=1/C11H14N2/c1-2-13(10-6-9-12)11-7-4-3-5-8-11/h3-5,7-8H,2,6,10H2,1H3 |
cas번호 |
148-87-8 |
EC번호 |
205-728-4 |
분자 구조 |
|
밀도 |
1.022g/cm3 |
비등점 |
311.9°C at 760 mmHg |
굴절 지수 |
1.551 |
인화점 |
132.8°C |
증기압 |
0.000547mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|