14804-31-0 Bromomethoxytoluene
상품명칭 |
Bromomethoxytoluene |
영문 이름 |
Bromomethoxytoluene; 5-Bromo-2-methoxytoluene; 4-Bromo-2-methylanisole; 4-bromo-1-methoxy-2-methylbenzene |
분자식 |
C8H9BrO |
분자량 |
201.0605 |
InChI |
InChI=1/C8H9BrO/c1-6-5-7(9)3-4-8(6)10-2/h3-5H,1-2H3 |
cas번호 |
14804-31-0 |
분자 구조 |
|
밀도 |
1.378g/cm3 |
녹는 점 |
66-69℃ |
비등점 |
226.1°C at 760 mmHg |
굴절 지수 |
1.535 |
인화점 |
102.3°C |
증기압 |
0.125mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|