ChemNet > CAS > 1481-02-3 1-Methyl-3-trifluoromethyl-2-pyrazolin-5-one
1481-02-3 1-Methyl-3-trifluoromethyl-2-pyrazolin-5-one
상품명칭 |
1-Methyl-3-trifluoromethyl-2-pyrazolin-5-one |
영문 이름 |
1-Methyl-3-trifluoromethyl-2-pyrazolin-5-one; 1-Methyl-3-trifluormethyl-2-pyrazolin-5-one; 1-(4-fluoro-2-hydroxy-phenyl)ethanone |
분자식 |
C8H7FO2 |
분자량 |
154.1384 |
InChI |
InChI=1/C8H7FO2/c1-5(10)7-3-2-6(9)4-8(7)11/h2-4,11H,1H3 |
cas번호 |
1481-02-3 |
분자 구조 |
|
밀도 |
1.247g/cm3 |
녹는 점 |
178-180℃ |
비등점 |
237.495°C at 760 mmHg |
굴절 지수 |
1.53 |
인화점 |
97.434°C |
증기압 |
0.029mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|