ChemNet > CAS > 1483-27-8 2,5-Dimethoxythiophenol
1483-27-8 2,5-Dimethoxythiophenol
| 상품명칭 |
2,5-Dimethoxythiophenol |
| 영문 이름 |
2,5-Dimethoxythiophenol; 2,5-Dimethoxybenzenethiol |
| 분자식 |
C8H10O2S |
| 분자량 |
170.2288 |
| InChI |
InChI=1/C8H10O2S/c1-9-6-3-4-7(10-2)8(11)5-6/h3-5,11H,1-2H3 |
| cas번호 |
1483-27-8 |
| 분자 구조 |
|
| 밀도 |
1.134g/cm3 |
| 비등점 |
278.8°C at 760 mmHg |
| 굴절 지수 |
1.549 |
| 인화점 |
122.4°C |
| 증기압 |
0.00707mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
