ChemNet > CAS > 149-82-6 cyclohexyldimethylammonium dibutyldithiocarbamate
149-82-6 cyclohexyldimethylammonium dibutyldithiocarbamate
상품명칭 |
cyclohexyldimethylammonium dibutyldithiocarbamate |
영문 이름 |
cyclohexyldimethylammonium dibutyldithiocarbamate;Cyclohexyldimethylammonium dibutyldithiocarbamate; Carbamodithioic acid, N,N-dibutyl-, compd. with N,N-dimethylcyclohexanamine (1:1); Carbamodithioic acid, dibutyl-, compd. with N,N-dimethylcyclohexanamine (1:1); dibutylcarbamodithioic acid - N,N-dimethylcyclohexanamine (1:1) |
분자식 |
C17H36N2S2 |
분자량 |
332.6111 |
InChI |
InChI=1/C9H19NS2.C8H17N/c1-3-5-7-10(9(11)12)8-6-4-2;1-9(2)8-6-4-3-5-7-8/h3-8H2,1-2H3,(H,11,12);8H,3-7H2,1-2H3 |
cas번호 |
149-82-6 |
EC번호 |
205-747-8 |
분자 구조 |
|
비등점 |
257.7°C at 760 mmHg |
인화점 |
109.6°C |
증기압 |
0.0144mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|