1492-30-4 4-nitrophenyl palmitate
상품명칭 |
4-nitrophenyl palmitate |
영문 이름 |
4-nitrophenyl palmitate; 4-Nitrophenyl hexadecanoate; Palmitic acid 4-nitrophenyl ester; 4-Nitrophenol palmitate |
분자식 |
C22H35NO4 |
분자량 |
377.5176 |
InChI |
InChI=1/C22H35NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-22(24)27-21-18-16-20(17-19-21)23(25)26/h16-19H,2-15H2,1H3 |
cas번호 |
1492-30-4 |
EC번호 |
216-084-9 |
분자 구조 |
|
밀도 |
1.02g/cm3 |
녹는 점 |
60℃ |
비등점 |
483.6°C at 760 mmHg |
굴절 지수 |
1.5 |
인화점 |
160.7°C |
증기압 |
1.66E-09mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|