ChemNet > CAS > 14984-21-5 Bis(4-phenoxyphenyl)methanone
14984-21-5 Bis(4-phenoxyphenyl)methanone
상품명칭 |
Bis(4-phenoxyphenyl)methanone |
영문 이름 |
Bis(4-phenoxyphenyl)methanone; 4,4-Diphenoxybenzophenone; 4,4'-Diphenoxybenzophenone |
분자식 |
C25H18O3 |
분자량 |
366.4086 |
InChI |
InChI=1/C25H18O3/c26-25(19-11-15-23(16-12-19)27-21-7-3-1-4-8-21)20-13-17-24(18-14-20)28-22-9-5-2-6-10-22/h1-18H |
cas번호 |
14984-21-5 |
EC번호 |
403-390-4 |
분자 구조 |
|
밀도 |
1.186g/cm3 |
비등점 |
514.4°C at 760 mmHg |
굴절 지수 |
1.623 |
인화점 |
257.3°C |
증기압 |
1.08E-10mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|