ChemNet > CAS > 150-83-4 3-hydroxybutyric acid, sodium salt
150-83-4 3-hydroxybutyric acid, sodium salt
상품명칭 |
3-hydroxybutyric acid, sodium salt |
영문 이름 |
3-hydroxybutyric acid, sodium salt; 3-Hydroxybutyric acid sodium salt; DL-beta-Hydroxybutyric acid sodium salt; Sodium 3-hydroxybutyrate; sodium 3-hydroxybutanoate; butanoic acid, 3-hydroxy-, sodium salt (1:1); Dl-3-Hydroxybutyric Acid Sodium Salt |
분자식 |
C4H8NaO3 |
분자량 |
127.0943 |
InChI |
InChI=1/C4H8O3.Na/c1-3(5)2-4(6)7;/h3,5H,2H2,1H3,(H,6,7); |
cas번호 |
150-83-4 |
EC번호 |
205-774-5 |
분자 구조 |
|
녹는 점 |
165-167℃ |
비등점 |
269.2°C at 760 mmHg |
인화점 |
121°C |
증기압 |
0.000979mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|