ChemNet > CAS > 1501-06-0 Diethyl 2-acetylglutarate
1501-06-0 Diethyl 2-acetylglutarate
상품명칭 |
Diethyl 2-acetylglutarate |
영문 이름 |
Diethyl 2-acetylglutarate; 2-Acetylglutaric acid diethyl ester; diethyl 2-acetylpentanedioate; diethyl (2R)-2-acetylpentanedioate; diethyl (2S)-2-acetylpentanedioate |
분자식 |
C11H18O5 |
분자량 |
230.2576 |
InChI |
InChI=1/C11H18O5/c1-4-15-10(13)7-6-9(8(3)12)11(14)16-5-2/h9H,4-7H2,1-3H3/t9-/m0/s1 |
cas번호 |
1501-06-0 |
EC번호 |
216-114-0 |
분자 구조 |
|
밀도 |
1.073g/cm3 |
비등점 |
291.2°C at 760 mmHg |
굴절 지수 |
1.439 |
인화점 |
127.5°C |
증기압 |
0.00198mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|