ChemNet > CAS > 1501-27-5 mono-methyl glutarate
1501-27-5 mono-methyl glutarate
| 상품명칭 |
mono-methyl glutarate |
| 영문 이름 |
mono-methyl glutarate; Methyl hydrogen glutarate; Glutaric acid monomethyl ester; Monomethyl glutarate; Pentanedioic acid monomethyl ester; Monoethyl Glutaric Acid; 5-methoxy-5-oxopentanoic acid; 5-methoxy-5-oxopentanoate; 5-{[5-methyl-2-(propan-2-yl)cyclohexyl]oxy}-5-oxopentanoic acid |
| 분자식 |
C15H26O4 |
| 분자량 |
270.3645 |
| InChI |
InChI=1/C15H26O4/c1-10(2)12-8-7-11(3)9-13(12)19-15(18)6-4-5-14(16)17/h10-13H,4-9H2,1-3H3,(H,16,17) |
| cas번호 |
1501-27-5 |
| EC번호 |
216-116-1 |
| 분자 구조 |
|
| 밀도 |
1.05g/cm3 |
| 비등점 |
393.406°C at 760 mmHg |
| 굴절 지수 |
1.478 |
| 인화점 |
137.448°C |
| 증기압 |
0mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
| 보안 규칙 |
S23:;
S24/25:;
|
|
