ChemNet > CAS > 151096-42-3 2-Bromo-3,4,5,6-tetrafluorobenzoylchloride
151096-42-3 2-Bromo-3,4,5,6-tetrafluorobenzoylchloride
상품명칭 |
2-Bromo-3,4,5,6-tetrafluorobenzoylchloride |
영문 이름 |
2-Bromo-3,4,5,6-tetrafluorobenzoylchloride; 2-Bromo-3,4,5,6-tetrafluorobenzoyl chloride |
분자식 |
C7BrClF4O |
분자량 |
291.4249 |
InChI |
InChI=1/C7BrClF4O/c8-2-1(7(9)14)3(10)5(12)6(13)4(2)11 |
cas번호 |
151096-42-3 |
분자 구조 |
|
밀도 |
1.957g/cm3 |
비등점 |
216.6°C at 760 mmHg |
굴절 지수 |
1.505 |
인화점 |
84.8°C |
증기압 |
0.139mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|