ChemNet > CAS > 151411-98-2 2,4,6-Trifluorobenzyl bromide
151411-98-2 2,4,6-Trifluorobenzyl bromide
상품명칭 |
2,4,6-Trifluorobenzyl bromide |
영문 이름 |
2,4,6-Trifluorobenzyl bromide; alpha-Bromo-2,4,6-trifluorotoluene; 2-(bromomethyl)-1,3,5-trifluorobenzene |
분자식 |
C7H4BrF3 |
분자량 |
225.0059 |
InChI |
InChI=1/C7H4BrF3/c8-3-5-6(10)1-4(9)2-7(5)11/h1-2H,3H2 |
cas번호 |
151411-98-2 |
분자 구조 |
|
밀도 |
1.71g/cm3 |
비등점 |
177.4°C at 760 mmHg |
굴절 지수 |
1.502 |
인화점 |
66.1°C |
증기압 |
1.4mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
R36:Irritating to eyes.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|