ChemNet > CAS > 151982-51-3 4-Bromo-2-fluorobenzoyl chloride
151982-51-3 4-Bromo-2-fluorobenzoyl chloride
상품명칭 |
4-Bromo-2-fluorobenzoyl chloride |
영문 이름 |
4-Bromo-2-fluorobenzoyl chloride; 2-Fluoro-4-Bromobenzoyl Chloride; 2-fluoro-4-broMobenzyl chloride |
분자식 |
C7H3BrClFO |
분자량 |
237.4535 |
InChI |
InChI=1/C7H3BrClFO/c8-4-1-2-5(7(9)11)6(10)3-4/h1-3H |
cas번호 |
151982-51-3 |
분자 구조 |
|
밀도 |
1.742g/cm3 |
비등점 |
236.9°C at 760 mmHg |
굴절 지수 |
1.561 |
인화점 |
97.1°C |
증기압 |
0.0462mmHg at 25°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|