| 상품명칭 |
2,5-Bis(4-pyridyl)-1,3,4-thiadiazole |
| 영문 이름 |
2,5-Bis(4-pyridyl)-1,3,4-thiadiazole; 4,4'-(2,5-dihydro-1,3,4-thiadiazole-2,5-diyl)dipyridine; Pyridine, 4,4'-(1,3,4-thiadiazole-2,5-diyl)di-; 1,3,4-Thiazole, 2,5-bis(4-piridinyl)-; 2,5-Bis(4-piridinyl)-1,3,4-thiadiazole; 4,4'-(1,3,4-Thiadiazole-2,5-diyl)dipyridine; 4-27-00-09589 (Beilstein Handbook Reference); BRN 0198070; NSC 34795 |
| 분자식 |
C12H8N4S |
| 분자량 |
240.2837 |
| InChI |
InChI=1/C12H8N4S/c1-5-13-6-2-9(1)11-15-16-12(17-11)10-3-7-14-8-4-10/h1-8H |
| cas번호 |
15311-09-8;54010-21-8 |
| EC번호 |
239-353-2 |
| 분자 구조 |
|
| 밀도 |
1.317g/cm3 |
| 녹는 점 |
237-244℃ |
| 비등점 |
475.9°C at 760 mmHg |
| 굴절 지수 |
1.645 |
| 인화점 |
238.6°C |
| 증기압 |
9.14E-09mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
