ChemNet > CAS > 15329-69-8 N-Benzylmaleamic acid
15329-69-8 N-Benzylmaleamic acid
| 상품명칭 |
N-Benzylmaleamic acid |
| 영문 이름 |
N-Benzylmaleamic acid; Maleic acid monobenzylamide; 4-(benzylamino)-4-oxobut-2-enoic acid; (2Z)-4-(benzylamino)-4-oxobut-2-enoic acid; (2E)-4-(benzylamino)-4-oxobut-2-enoate |
| 분자식 |
C11H10NO3 |
| 분자량 |
204.2025 |
| InChI |
InChI=1/C11H11NO3/c13-10(6-7-11(14)15)12-8-9-4-2-1-3-5-9/h1-7H,8H2,(H,12,13)(H,14,15)/p-1/b7-6+ |
| cas번호 |
15329-69-8 |
| EC번호 |
239-361-6 |
| 분자 구조 |
|
| 녹는 점 |
136-138℃ |
| 비등점 |
476.3°C at 760 mmHg |
| 인화점 |
241.9°C |
| 증기압 |
7.01E-10mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
