1539-04-4 Diphenyl tere-phthalate
상품명칭 |
Diphenyl tere-phthalate |
영문 이름 |
Diphenyl tere-phthalate; Diphenyl terephthalate; Terephthalic acid diphenyl ester; diphenyl benzene-1,4-dicarboxylate |
분자식 |
C20H14O4 |
분자량 |
318.3228 |
InChI |
InChI=1/C20H14O4/c21-19(23-17-7-3-1-4-8-17)15-11-13-16(14-12-15)20(22)24-18-9-5-2-6-10-18/h1-14H |
cas번호 |
1539-04-4 |
EC번호 |
216-264-7 |
분자 구조 |
|
밀도 |
1.242g/cm3 |
녹는 점 |
197-199℃ |
비등점 |
496.6°C at 760 mmHg |
굴절 지수 |
1.615 |
인화점 |
255°C |
증기압 |
5.34E-10mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|