15414-98-9 트리페닐카르베늄 펜타클로로스탄네이트
상품명칭 |
트리페닐카르베늄 펜타클로로스탄네이트 |
별명 |
; 트리틸 펜타클로로스탄산염; 주석 (4 ) 트리 페닐 메틸륨 클로라이드 (1 : 1 : 5) |
영문 이름 |
Triphenylcarbenium pentachlorostannate; Trityl pentachlorostannate; tin(4+) triphenylmethylium chloride (1:1:5) |
분자식 |
C19H15Cl5Sn |
분자량 |
539.2974 |
InChI |
InChI=1/C19H15.5ClH.Sn/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;;;/h1-15H;5*1H;/q+1;;;;;;+4/p-5 |
cas번호 |
15414-98-9 |
EC번호 |
239-426-9 |
분자 구조 |
|
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
|
|