ChemNet > CAS > 154257-75-7 3-Chloro-2,4-difluorobenzoic acid
154257-75-7 3-Chloro-2,4-difluorobenzoic acid
상품명칭 |
3-Chloro-2,4-difluorobenzoic acid |
영문 이름 |
3-Chloro-2,4-difluorobenzoic acid; 1-fluoro-4-isothiocyanatobenzene; 3-chloro-2,4-difluorobenzoate; 3-Chloro-2,4-Difluoro-Benzoic Acid |
분자식 |
C7H2ClF2O2 |
분자량 |
191.5399 |
InChI |
InChI=1/C7H3ClF2O2/c8-5-4(9)2-1-3(6(5)10)7(11)12/h1-2H,(H,11,12)/p-1 |
cas번호 |
154257-75-7 |
EC번호 |
216-280-4 |
분자 구조 |
|
비등점 |
276.7°C at 760 mmHg |
인화점 |
121.1°C |
증기압 |
0.00228mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|