ChemNet > CAS > 1544-85-0 2,2-difluoro-5-aminobenzodioxole
1544-85-0 2,2-difluoro-5-aminobenzodioxole
상품명칭 |
2,2-difluoro-5-aminobenzodioxole |
영문 이름 |
2,2-difluoro-5-aminobenzodioxole; 2,2-Difluoro-5-amino-1,3-benzodioxole; 2,2-difluorobenzo[d][1,3]dioxol-5-amine; 1-(difluoromethoxy)-4-nitrobenzene; 2,2-Difluoro-5-aminobenzo[d][1,3]dioxole |
분자식 |
C7H5F2NO3 |
분자량 |
189.1163 |
InChI |
InChI=1/C7H5F2NO3/c8-7(9)13-6-3-1-5(2-4-6)10(11)12/h1-4,7H |
cas번호 |
1544-85-0 |
분자 구조 |
|
밀도 |
1.384g/cm3 |
비등점 |
259.6°C at 760 mmHg |
굴절 지수 |
1.494 |
인화점 |
110.8°C |
증기압 |
0.0208mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|