ChemNet > CAS > 15547-89-4 2-(3-Methoxyphenyl)cyclohexanone
15547-89-4 2-(3-Methoxyphenyl)cyclohexanone
상품명칭 |
2-(3-Methoxyphenyl)cyclohexanone |
영문 이름 |
2-(3-Methoxyphenyl)cyclohexanone;Cyclohexanone, 2-(3-methoxyphenyl)-; (2R)-2-(3-methoxyphenyl)cyclohexanone; (2S)-2-(3-methoxyphenyl)cyclohexanone |
분자식 |
C13H16O2 |
분자량 |
204.2649 |
InChI |
InChI=1/C13H16O2/c1-15-11-6-4-5-10(9-11)12-7-2-3-8-13(12)14/h4-6,9,12H,2-3,7-8H2,1H3/t12-/m0/s1 |
cas번호 |
15547-89-4 |
EC번호 |
239-602-5 |
분자 구조 |
|
밀도 |
1.068g/cm3 |
비등점 |
332.6°C at 760 mmHg |
굴절 지수 |
1.528 |
인화점 |
147.8°C |
증기압 |
0.000144mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|